C22H26ClN3O4 — CID 141350707
benzyl N-[(1R)-2-(butylamino)-1-[3-[(2-chloroacetyl)amino]phenyl]-2-oxoethyl]carbamate (PubChem CID 141350707) has the molecular formula C22H26ClN3O4 and a molecular weight of 431.92 g/mol. Its IUPAC name is benzyl N-[(1R)-2-(butylamino)-1-[3-[(2-chloroacetyl)amino]phenyl]-2-oxoethyl]carbamate.
| Compound Name | benzyl N-[(1R)-2-(butylamino)-1-[3-[(2-chloroacetyl)amino]phenyl]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 141350707 |
| Molecular Formula | C22H26ClN3O4 |
| Molecular Weight | 431.92 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | benzyl N-[(1R)-2-(butylamino)-1-[3-[(2-chloroacetyl)amino]phenyl]-2-oxoethyl]carbamate |
| SMILES | CCCCNC(=O)[C@H](NC(=O)OCc1ccccc1)c1cccc(NC(=O)CCl)c1 |
| InChI | InChI=1S/C22H26ClN3O4/c1-2-3-12-24-21(28)20(17-10-7-11-18(13-17)25-19(27)14-23)26-22(29)30-15-16-8-5-4-6-9-16/h4-11,13,20H,2-3,12,14-15H2,1H3,(H,24,28)(H,25,27)(H,26,29)/t20-/m1/s1 |
| InChIKey | UYXGWDLAZSBNCH-HXUWFJFHSA-N |
| XLogP | 3.75 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.92 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|