C27H29N3O5 — CID 57147486
2-(benzhydrylcarbamoylamino)-5-(phenylmethoxycarbonylamino)pentanoic acid (PubChem CID 57147486) has the molecular formula C27H29N3O5 and a molecular weight of 475.55 g/mol. Its IUPAC name is 2-(benzhydrylcarbamoylamino)-5-(phenylmethoxycarbonylamino)pentanoic acid.
| Compound Name | 2-(benzhydrylcarbamoylamino)-5-(phenylmethoxycarbonylamino)pentanoic acid |
|---|---|
| PubChem CID | 57147486 |
| Molecular Formula | C27H29N3O5 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | 2-(benzhydrylcarbamoylamino)-5-(phenylmethoxycarbonylamino)pentanoic acid |
| SMILES | O=C(NC(CCCNC(=O)OCc1ccccc1)C(=O)O)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H29N3O5/c31-25(32)23(17-10-18-28-27(34)35-19-20-11-4-1-5-12-20)29-26(33)30-24(21-13-6-2-7-14-21)22-15-8-3-9-16-22/h1-9,11-16,23-24H,10,17-19H2,(H,28,34)(H,31,32)(H2,29,30,33) |
| InChIKey | QTYYLQXMWGHLNO-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|