C24H30N2O5 — CID 45033062
(2R)-6-(phenylmethoxycarbonylamino)-2-[(2,4,6-trimethylbenzoyl)amino]hexanoic acid (PubChem CID 45033062) has the molecular formula C24H30N2O5 and a molecular weight of 426.51 g/mol. Its IUPAC name is (2R)-6-(phenylmethoxycarbonylamino)-2-[(2,4,6-trimethylbenzoyl)amino]hexanoic acid.
| Compound Name | (2R)-6-(phenylmethoxycarbonylamino)-2-[(2,4,6-trimethylbenzoyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 45033062 |
| Molecular Formula | C24H30N2O5 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | (2R)-6-(phenylmethoxycarbonylamino)-2-[(2,4,6-trimethylbenzoyl)amino]hexanoic acid |
| SMILES | Cc1cc(C)c(C(=O)N[C@H](CCCCNC(=O)OCc2ccccc2)C(=O)O)c(C)c1 |
| InChI | InChI=1S/C24H30N2O5/c1-16-13-17(2)21(18(3)14-16)22(27)26-20(23(28)29)11-7-8-12-25-24(30)31-15-19-9-5-4-6-10-19/h4-6,9-10,13-14,20H,7-8,11-12,15H2,1-3H3,(H,25,30)(H,26,27)(H,28,29)/t20-/m1/s1 |
| InChIKey | BOBRJWSPRZGIPO-HXUWFJFHSA-N |
| XLogP | 3.89 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|