C26H31N3O8S — CID 10119867
(2R)-2-[[2-[carboxymethyl-(4-methylsulfanylbenzoyl)amino]acetyl]amino]-6-(phenylmethoxycarbonylamino)hexanoic acid (PubChem CID 10119867) has the molecular formula C26H31N3O8S and a molecular weight of 545.61 g/mol. Its IUPAC name is (2R)-2-[[2-[carboxymethyl-(4-methylsulfanylbenzoyl)amino]acetyl]amino]-6-(phenylmethoxycarbonylamino)hexanoic acid.
| Compound Name | (2R)-2-[[2-[carboxymethyl-(4-methylsulfanylbenzoyl)amino]acetyl]amino]-6-(phenylmethoxycarbonylamino)hexanoic acid |
|---|---|
| PubChem CID | 10119867 |
| Molecular Formula | C26H31N3O8S |
| Molecular Weight | 545.61 g/mol |
| Exact Mass | 545.18 |
| IUPAC Name | (2R)-2-[[2-[carboxymethyl-(4-methylsulfanylbenzoyl)amino]acetyl]amino]-6-(phenylmethoxycarbonylamino)hexanoic acid |
| SMILES | CSc1ccc(C(=O)N(CC(=O)O)CC(=O)N[C@H](CCCCNC(=O)OCc2ccccc2)C(=O)O)cc1 |
| InChI | InChI=1S/C26H31N3O8S/c1-38-20-12-10-19(11-13-20)24(33)29(16-23(31)32)15-22(30)28-21(25(34)35)9-5-6-14-27-26(36)37-17-18-7-3-2-4-8-18/h2-4,7-8,10-13,21H,5-6,9,14-17H2,1H3,(H,27,36)(H,28,30)(H,31,32)(H,34,35)/t21-/m1/s1 |
| InChIKey | FKYLPBRJIQKBFC-OAQYLSRUSA-N |
| XLogP | 2.60 |
| TPSA | 162.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.61 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|