C26H33N3O6 — CID 70269079
(2S)-2-[[2-[methyl(3-phenylpropanoyl)amino]acetyl]amino]-6-(phenylmethoxycarbonylamino)hexanoic acid (PubChem CID 70269079) has the molecular formula C26H33N3O6 and a molecular weight of 483.57 g/mol. Its IUPAC name is (2S)-2-[[2-[methyl(3-phenylpropanoyl)amino]acetyl]amino]-6-(phenylmethoxycarbonylamino)hexanoic acid.
| Compound Name | (2S)-2-[[2-[methyl(3-phenylpropanoyl)amino]acetyl]amino]-6-(phenylmethoxycarbonylamino)hexanoic acid |
|---|---|
| PubChem CID | 70269079 |
| Molecular Formula | C26H33N3O6 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.24 |
| IUPAC Name | (2S)-2-[[2-[methyl(3-phenylpropanoyl)amino]acetyl]amino]-6-(phenylmethoxycarbonylamino)hexanoic acid |
| SMILES | CN(CC(=O)N[C@@H](CCCCNC(=O)OCc1ccccc1)C(=O)O)C(=O)CCc1ccccc1 |
| InChI | InChI=1S/C26H33N3O6/c1-29(24(31)16-15-20-10-4-2-5-11-20)18-23(30)28-22(25(32)33)14-8-9-17-27-26(34)35-19-21-12-6-3-7-13-21/h2-7,10-13,22H,8-9,14-19H2,1H3,(H,27,34)(H,28,30)(H,32,33)/t22-/m0/s1 |
| InChIKey | LPMIPMIHGCUGMV-QFIPXVFZSA-N |
| XLogP | 2.74 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|