C32H36Br2N4O6 — CID 11513270
(2S)-2-[[(2R)-3-(4-amino-3,5-dibromophenyl)-2-(3-phenylpropanoylamino)propanoyl]amino]-6-(phenylmethoxycarbonylamino)hexanoic acid (PubChem CID 11513270) has the molecular formula C32H36Br2N4O6 and a molecular weight of 732.47 g/mol. Its IUPAC name is (2S)-2-[[(2R)-3-(4-amino-3,5-dibromophenyl)-2-(3-phenylpropanoylamino)propanoyl]amino]-6-(phenylmethoxycarbonylamino)hexanoic acid.
| Compound Name | (2S)-2-[[(2R)-3-(4-amino-3,5-dibromophenyl)-2-(3-phenylpropanoylamino)propanoyl]amino]-6-(phenylmethoxycarbonylamino)hexanoic acid |
|---|---|
| PubChem CID | 11513270 |
| Molecular Formula | C32H36Br2N4O6 |
| Molecular Weight | 732.47 g/mol |
| Exact Mass | 730.10 |
| IUPAC Name | (2S)-2-[[(2R)-3-(4-amino-3,5-dibromophenyl)-2-(3-phenylpropanoylamino)propanoyl]amino]-6-(phenylmethoxycarbonylamino)hexanoic acid |
| SMILES | Nc1c(Br)cc(C[C@@H](NC(=O)CCc2ccccc2)C(=O)N[C@@H](CCCCNC(=O)OCc2ccccc2)C(=O)O)cc1Br |
| InChI | InChI=1S/C32H36Br2N4O6/c33-24-17-23(18-25(34)29(24)35)19-27(37-28(39)15-14-21-9-3-1-4-10-21)30(40)38-26(31(41)42)13-7-8-16-36-32(43)44-20-22-11-5-2-6-12-22/h1-6,9-12,17-18,26-27H,7-8,13-16,19-20,35H2,(H,36,43)(H,37,39)(H,38,40)(H,41,42)/t26-,27+/m0/s1 |
| InChIKey | GWGGXIWEJRQRCU-RRPNLBNLSA-N |
| XLogP | 5.12 |
| TPSA | 159.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.47 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|