C31H35N3O7 — CID 50914012
(2S)-2-[[(2S)-1-oxo-1-phenylmethoxy-6-(phenylmethoxycarbonylamino)hexan-2-yl]carbamoylamino]-3-phenylpropanoic acid (PubChem CID 50914012) has the molecular formula C31H35N3O7 and a molecular weight of 561.64 g/mol. Its IUPAC name is (2S)-2-[[(2S)-1-oxo-1-phenylmethoxy-6-(phenylmethoxycarbonylamino)hexan-2-yl]carbamoylamino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[[(2S)-1-oxo-1-phenylmethoxy-6-(phenylmethoxycarbonylamino)hexan-2-yl]carbamoylamino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 50914012 |
| Molecular Formula | C31H35N3O7 |
| Molecular Weight | 561.64 g/mol |
| Exact Mass | 561.25 |
| IUPAC Name | (2S)-2-[[(2S)-1-oxo-1-phenylmethoxy-6-(phenylmethoxycarbonylamino)hexan-2-yl]carbamoylamino]-3-phenylpropanoic acid |
| SMILES | O=C(N[C@@H](Cc1ccccc1)C(=O)O)N[C@@H](CCCCNC(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C31H35N3O7/c35-28(36)27(20-23-12-4-1-5-13-23)34-30(38)33-26(29(37)40-21-24-14-6-2-7-15-24)18-10-11-19-32-31(39)41-22-25-16-8-3-9-17-25/h1-9,12-17,26-27H,10-11,18-22H2,(H,32,39)(H,35,36)(H2,33,34,38)/t26-,27-/m0/s1 |
| InChIKey | DLXPLSCBQGNODQ-SVBPBHIXSA-N |
| XLogP | 4.19 |
| TPSA | 143.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.64 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|