C23H30N4O4 — CID 123583612
benzyl N-[5-amino-6-[(1-amino-1-oxo-3-phenylpropan-2-yl)amino]-6-oxohexyl]carbamate (PubChem CID 123583612) has the molecular formula C23H30N4O4 and a molecular weight of 426.52 g/mol. Its IUPAC name is benzyl N-[5-amino-6-[(1-amino-1-oxo-3-phenylpropan-2-yl)amino]-6-oxohexyl]carbamate.
| Compound Name | benzyl N-[5-amino-6-[(1-amino-1-oxo-3-phenylpropan-2-yl)amino]-6-oxohexyl]carbamate |
|---|---|
| PubChem CID | 123583612 |
| Molecular Formula | C23H30N4O4 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | benzyl N-[5-amino-6-[(1-amino-1-oxo-3-phenylpropan-2-yl)amino]-6-oxohexyl]carbamate |
| SMILES | NC(=O)C(Cc1ccccc1)NC(=O)C(N)CCCCNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H30N4O4/c24-19(22(29)27-20(21(25)28)15-17-9-3-1-4-10-17)13-7-8-14-26-23(30)31-16-18-11-5-2-6-12-18/h1-6,9-12,19-20H,7-8,13-16,24H2,(H2,25,28)(H,26,30)(H,27,29) |
| InChIKey | UARPHSBOPCNRLC-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 136.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|