C30H43N7O5 — CID 163688302
benzyl N-[(5S)-6-amino-5-[[(2R,5S)-5-amino-2-benzyl-8-(diaminomethylideneamino)-4-oxooctanoyl]amino]-6-oxohexyl]carbamate (PubChem CID 163688302) has the molecular formula C30H43N7O5 and a molecular weight of 581.72 g/mol. Its IUPAC name is benzyl N-[(5S)-6-amino-5-[[(2R,5S)-5-amino-2-benzyl-8-(diaminomethylideneamino)-4-oxooctanoyl]amino]-6-oxohexyl]carbamate.
| Compound Name | benzyl N-[(5S)-6-amino-5-[[(2R,5S)-5-amino-2-benzyl-8-(diaminomethylideneamino)-4-oxooctanoyl]amino]-6-oxohexyl]carbamate |
|---|---|
| PubChem CID | 163688302 |
| Molecular Formula | C30H43N7O5 |
| Molecular Weight | 581.72 g/mol |
| Exact Mass | 581.33 |
| IUPAC Name | benzyl N-[(5S)-6-amino-5-[[(2R,5S)-5-amino-2-benzyl-8-(diaminomethylideneamino)-4-oxooctanoyl]amino]-6-oxohexyl]carbamate |
| SMILES | NC(=O)[C@H](CCCCNC(=O)OCc1ccccc1)NC(=O)[C@@H](CC(=O)[C@@H](N)CCCN=C(N)N)Cc1ccccc1 |
| InChI | InChI=1S/C30H43N7O5/c31-24(14-9-17-35-29(33)34)26(38)19-23(18-21-10-3-1-4-11-21)28(40)37-25(27(32)39)15-7-8-16-36-30(41)42-20-22-12-5-2-6-13-22/h1-6,10-13,23-25H,7-9,14-20,31H2,(H2,32,39)(H,36,41)(H,37,40)(H4,33,34,35)/t23-,24+,25+/m1/s1 |
| InChIKey | RWGMGBNICJVACC-DSITVLBTSA-N |
| XLogP | 1.25 |
| TPSA | 218.01 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.72 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|