C30H44N8O4 — CID 163906831
(2R,5R)-5-[[(2S)-2-amino-2-phenylacetyl]amino]-2-benzyl-8-(diaminomethylideneamino)-N-[(2S)-1,6-diamino-1-oxohexan-2-yl]-4-oxooctanamide (PubChem CID 163906831) has the molecular formula C30H44N8O4 and a molecular weight of 580.73 g/mol. Its IUPAC name is (2R,5R)-5-[[(2S)-2-amino-2-phenylacetyl]amino]-2-benzyl-8-(diaminomethylideneamino)-N-[(2S)-1,6-diamino-1-oxohexan-2-yl]-4-oxooctanamide.
| Compound Name | (2R,5R)-5-[[(2S)-2-amino-2-phenylacetyl]amino]-2-benzyl-8-(diaminomethylideneamino)-N-[(2S)-1,6-diamino-1-oxohexan-2-yl]-4-oxooctanamide |
|---|---|
| PubChem CID | 163906831 |
| Molecular Formula | C30H44N8O4 |
| Molecular Weight | 580.73 g/mol |
| Exact Mass | 580.35 |
| IUPAC Name | (2R,5R)-5-[[(2S)-2-amino-2-phenylacetyl]amino]-2-benzyl-8-(diaminomethylideneamino)-N-[(2S)-1,6-diamino-1-oxohexan-2-yl]-4-oxooctanamide |
| SMILES | NCCCC[C@H](NC(=O)[C@@H](CC(=O)[C@@H](CCCN=C(N)N)NC(=O)[C@@H](N)c1ccccc1)Cc1ccccc1)C(N)=O |
| InChI | InChI=1S/C30H44N8O4/c31-16-8-7-14-24(27(33)40)38-28(41)22(18-20-10-3-1-4-11-20)19-25(39)23(15-9-17-36-30(34)35)37-29(42)26(32)21-12-5-2-6-13-21/h1-6,10-13,22-24,26H,7-9,14-19,31-32H2,(H2,33,40)(H,37,42)(H,38,41)(H4,34,35,36)/t22-,23-,24+,26+/m1/s1 |
| InChIKey | QOQGVVINMQRAOT-BIATYSSJSA-N |
| XLogP | 0.14 |
| TPSA | 234.80 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.73 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|