C28H41N9O4 — CID 151320003
(2S)-6-amino-2-[[(2S)-2-[[(2R)-2-[[(2S)-2-amino-2-phenylacetyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-2-phenylacetyl]amino]hexanamide (PubChem CID 151320003) has the molecular formula C28H41N9O4 and a molecular weight of 567.70 g/mol. Its IUPAC name is (2S)-6-amino-2-[[(2S)-2-[[(2R)-2-[[(2S)-2-amino-2-phenylacetyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-2-phenylacetyl]amino]hexanamide.
| Compound Name | (2S)-6-amino-2-[[(2S)-2-[[(2R)-2-[[(2S)-2-amino-2-phenylacetyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-2-phenylacetyl]amino]hexanamide |
|---|---|
| PubChem CID | 151320003 |
| Molecular Formula | C28H41N9O4 |
| Molecular Weight | 567.70 g/mol |
| Exact Mass | 567.33 |
| IUPAC Name | (2S)-6-amino-2-[[(2S)-2-[[(2R)-2-[[(2S)-2-amino-2-phenylacetyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-2-phenylacetyl]amino]hexanamide |
| SMILES | NCCCC[C@H](NC(=O)[C@@H](NC(=O)[C@@H](CCCN=C(N)N)NC(=O)[C@@H](N)c1ccccc1)c1ccccc1)C(N)=O |
| InChI | InChI=1S/C28H41N9O4/c29-16-8-7-14-20(24(31)38)35-27(41)23(19-12-5-2-6-13-19)37-25(39)21(15-9-17-34-28(32)33)36-26(40)22(30)18-10-3-1-4-11-18/h1-6,10-13,20-23H,7-9,14-17,29-30H2,(H2,31,38)(H,35,41)(H,36,40)(H,37,39)(H4,32,33,34)/t20-,21+,22-,23-/m0/s1 |
| InChIKey | OGGJFDQRPVEQHK-BJESRGMDSA-N |
| XLogP | -0.82 |
| TPSA | 246.83 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.70 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|