C27H38N8O5 — CID 127039494
N-[(2S)-1-[[(2S)-6-amino-1-[[(1S)-2-amino-1-(4-hydroxyphenyl)-2-oxoethyl]amino]-1-oxohexan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]benzamide (PubChem CID 127039494) has the molecular formula C27H38N8O5 and a molecular weight of 554.65 g/mol. Its IUPAC name is N-[(2S)-1-[[(2S)-6-amino-1-[[(1S)-2-amino-1-(4-hydroxyphenyl)-2-oxoethyl]amino]-1-oxohexan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]benzamide.
| Compound Name | N-[(2S)-1-[[(2S)-6-amino-1-[[(1S)-2-amino-1-(4-hydroxyphenyl)-2-oxoethyl]amino]-1-oxohexan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]benzamide |
|---|---|
| PubChem CID | 127039494 |
| Molecular Formula | C27H38N8O5 |
| Molecular Weight | 554.65 g/mol |
| Exact Mass | 554.30 |
| IUPAC Name | N-[(2S)-1-[[(2S)-6-amino-1-[[(1S)-2-amino-1-(4-hydroxyphenyl)-2-oxoethyl]amino]-1-oxohexan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]benzamide |
| SMILES | NCCCC[C@H](NC(=O)[C@H](CCCN=C(N)N)NC(=O)c1ccccc1)C(=O)N[C@H](C(N)=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C27H38N8O5/c28-15-5-4-9-20(26(40)35-22(23(29)37)17-11-13-19(36)14-12-17)34-25(39)21(10-6-16-32-27(30)31)33-24(38)18-7-2-1-3-8-18/h1-3,7-8,11-14,20-22,36H,4-6,9-10,15-16,28H2,(H2,29,37)(H,33,38)(H,34,39)(H,35,40)(H4,30,31,32)/t20-,21-,22-/m0/s1 |
| InChIKey | NWAUGSSYRXDZMQ-FKBYEOEOSA-N |
| XLogP | -0.50 |
| TPSA | 241.04 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.65 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|