C28H40N8O4 — CID 155533808
N-[(2S)-1-[[(2S)-6-amino-1-[[(1R)-2-amino-2-oxo-1-phenylethyl]-methylamino]-1-oxohexan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]benzamide (PubChem CID 155533808) has the molecular formula C28H40N8O4 and a molecular weight of 552.68 g/mol. Its IUPAC name is N-[(2S)-1-[[(2S)-6-amino-1-[[(1R)-2-amino-2-oxo-1-phenylethyl]-methylamino]-1-oxohexan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]benzamide.
| Compound Name | N-[(2S)-1-[[(2S)-6-amino-1-[[(1R)-2-amino-2-oxo-1-phenylethyl]-methylamino]-1-oxohexan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]benzamide |
|---|---|
| PubChem CID | 155533808 |
| Molecular Formula | C28H40N8O4 |
| Molecular Weight | 552.68 g/mol |
| Exact Mass | 552.32 |
| IUPAC Name | N-[(2S)-1-[[(2S)-6-amino-1-[[(1R)-2-amino-2-oxo-1-phenylethyl]-methylamino]-1-oxohexan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]benzamide |
| SMILES | CN(C(=O)[C@H](CCCCN)NC(=O)[C@H](CCCN=C(N)N)NC(=O)c1ccccc1)[C@@H](C(N)=O)c1ccccc1 |
| InChI | InChI=1S/C28H40N8O4/c1-36(23(24(30)37)19-11-4-2-5-12-19)27(40)22(15-8-9-17-29)35-26(39)21(16-10-18-33-28(31)32)34-25(38)20-13-6-3-7-14-20/h2-7,11-14,21-23H,8-10,15-18,29H2,1H3,(H2,30,37)(H,34,38)(H,35,39)(H4,31,32,33)/t21-,22-,23+/m0/s1 |
| InChIKey | AQUGDLCQAZMZLW-RJGXRXQPSA-N |
| XLogP | 0.14 |
| TPSA | 212.02 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.68 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|