C16H23N5O4 — CID 67030984
(2S)-2-[[(2S)-2-benzamido-5-(diaminomethylideneamino)(113C)pentanoyl]amino]propanoic acid (PubChem CID 67030984) has the molecular formula C16H23N5O4 and a molecular weight of 350.38 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-benzamido-5-(diaminomethylideneamino)(113C)pentanoyl]amino]propanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-benzamido-5-(diaminomethylideneamino)(113C)pentanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 67030984 |
| Molecular Formula | C16H23N5O4 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | (2S)-2-[[(2S)-2-benzamido-5-(diaminomethylideneamino)(113C)pentanoyl]amino]propanoic acid |
| SMILES | C[C@H](N[13C](=O)[C@H](CCCN=C(N)N)NC(=O)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C16H23N5O4/c1-10(15(24)25)20-14(23)12(8-5-9-19-16(17)18)21-13(22)11-6-3-2-4-7-11/h2-4,6-7,10,12H,5,8-9H2,1H3,(H,20,23)(H,21,22)(H,24,25)(H4,17,18,19)/t10-,12-/m0/s1/i14+1 |
| InChIKey | VGXSPYVQJYWUKM-YDMVHPBRSA-N |
| XLogP | -0.57 |
| TPSA | 159.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|