C21H33N5O2 — CID 10643949
N-[(2S)-1-(cyclooctylamino)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]benzamide (PubChem CID 10643949) has the molecular formula C21H33N5O2 and a molecular weight of 387.53 g/mol. Its IUPAC name is N-[(2S)-1-(cyclooctylamino)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]benzamide.
| Compound Name | N-[(2S)-1-(cyclooctylamino)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]benzamide |
|---|---|
| PubChem CID | 10643949 |
| Molecular Formula | C21H33N5O2 |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.26 |
| IUPAC Name | N-[(2S)-1-(cyclooctylamino)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]benzamide |
| SMILES | NC(N)=NCCC[C@H](NC(=O)c1ccccc1)C(=O)NC1CCCCCCC1 |
| InChI | InChI=1S/C21H33N5O2/c22-21(23)24-15-9-14-18(26-19(27)16-10-5-4-6-11-16)20(28)25-17-12-7-2-1-3-8-13-17/h4-6,10-11,17-18H,1-3,7-9,12-15H2,(H,25,28)(H,26,27)(H4,22,23,24)/t18-/m0/s1 |
| InChIKey | FTHYZIKARANXFS-SFHVURJKSA-N |
| XLogP | 2.07 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|