C23H34N2O3S — CID 23636245
S-[(6S)-6-benzamido-7-(cyclopentylamino)-7-oxoheptyl] 2-methylpropanethioate (PubChem CID 23636245) has the molecular formula C23H34N2O3S and a molecular weight of 418.60 g/mol. Its IUPAC name is S-[(6S)-6-benzamido-7-(cyclopentylamino)-7-oxoheptyl] 2-methylpropanethioate.
| Compound Name | S-[(6S)-6-benzamido-7-(cyclopentylamino)-7-oxoheptyl] 2-methylpropanethioate |
|---|---|
| PubChem CID | 23636245 |
| Molecular Formula | C23H34N2O3S |
| Molecular Weight | 418.60 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | S-[(6S)-6-benzamido-7-(cyclopentylamino)-7-oxoheptyl] 2-methylpropanethioate |
| SMILES | CC(C)C(=O)SCCCCC[C@H](NC(=O)c1ccccc1)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C23H34N2O3S/c1-17(2)23(28)29-16-10-4-7-15-20(22(27)24-19-13-8-9-14-19)25-21(26)18-11-5-3-6-12-18/h3,5-6,11-12,17,19-20H,4,7-10,13-16H2,1-2H3,(H,24,27)(H,25,26)/t20-/m0/s1 |
| InChIKey | QLIFSEMXYQRTKY-FQEVSTJZSA-N |
| XLogP | 4.32 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.60 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|