C23H39N3O4S — CID 118721868
S-[(6S)-7-(cyclohexylamino)-7-oxo-6-[[(2S)-6-oxopiperidine-2-carbonyl]amino]heptyl] 2-methylpropanethioate (PubChem CID 118721868) has the molecular formula C23H39N3O4S and a molecular weight of 453.65 g/mol. Its IUPAC name is S-[(6S)-7-(cyclohexylamino)-7-oxo-6-[[(2S)-6-oxopiperidine-2-carbonyl]amino]heptyl] 2-methylpropanethioate.
| Compound Name | S-[(6S)-7-(cyclohexylamino)-7-oxo-6-[[(2S)-6-oxopiperidine-2-carbonyl]amino]heptyl] 2-methylpropanethioate |
|---|---|
| PubChem CID | 118721868 |
| Molecular Formula | C23H39N3O4S |
| Molecular Weight | 453.65 g/mol |
| Exact Mass | 453.27 |
| IUPAC Name | S-[(6S)-7-(cyclohexylamino)-7-oxo-6-[[(2S)-6-oxopiperidine-2-carbonyl]amino]heptyl] 2-methylpropanethioate |
| SMILES | CC(C)C(=O)SCCCCC[C@H](NC(=O)[C@@H]1CCCC(=O)N1)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C23H39N3O4S/c1-16(2)23(30)31-15-8-4-7-12-19(21(28)24-17-10-5-3-6-11-17)26-22(29)18-13-9-14-20(27)25-18/h16-19H,3-15H2,1-2H3,(H,24,28)(H,25,27)(H,26,29)/t18-,19-/m0/s1 |
| InChIKey | HNHOXNQWGPWVAC-OALUTQOASA-N |
| XLogP | 3.07 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.65 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|