C20H28N2O3S — CID 160640880
(2S)-6-oxo-N-[(3S)-2-oxo-1-phenyl-8-sulfanyloctan-3-yl]piperidine-2-carboxamide (PubChem CID 160640880) has the molecular formula C20H28N2O3S and a molecular weight of 376.52 g/mol. Its IUPAC name is (2S)-6-oxo-N-[(3S)-2-oxo-1-phenyl-8-sulfanyloctan-3-yl]piperidine-2-carboxamide.
| Compound Name | (2S)-6-oxo-N-[(3S)-2-oxo-1-phenyl-8-sulfanyloctan-3-yl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 160640880 |
| Molecular Formula | C20H28N2O3S |
| Molecular Weight | 376.52 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | (2S)-6-oxo-N-[(3S)-2-oxo-1-phenyl-8-sulfanyloctan-3-yl]piperidine-2-carboxamide |
| SMILES | O=C1CCC[C@@H](C(=O)N[C@@H](CCCCCS)C(=O)Cc2ccccc2)N1 |
| InChI | InChI=1S/C20H28N2O3S/c23-18(14-15-8-3-1-4-9-15)16(10-5-2-6-13-26)22-20(25)17-11-7-12-19(24)21-17/h1,3-4,8-9,16-17,26H,2,5-7,10-14H2,(H,21,24)(H,22,25)/t16-,17-/m0/s1 |
| InChIKey | RGVUWIGYSQWUQR-IRXDYDNUSA-N |
| XLogP | 2.44 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.52 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|