C26H33ClN2O5 — CID 161374193
[(5S)-6-oxo-6-phenylmethoxy-5-[[(2S)-piperidine-2-carbonyl]amino]hexyl] benzoate;hydrochloride (PubChem CID 161374193) has the molecular formula C26H33ClN2O5 and a molecular weight of 489.01 g/mol. Its IUPAC name is [(5S)-6-oxo-6-phenylmethoxy-5-[[(2S)-piperidine-2-carbonyl]amino]hexyl] benzoate;hydrochloride.
| Compound Name | [(5S)-6-oxo-6-phenylmethoxy-5-[[(2S)-piperidine-2-carbonyl]amino]hexyl] benzoate;hydrochloride |
|---|---|
| PubChem CID | 161374193 |
| Molecular Formula | C26H33ClN2O5 |
| Molecular Weight | 489.01 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | [(5S)-6-oxo-6-phenylmethoxy-5-[[(2S)-piperidine-2-carbonyl]amino]hexyl] benzoate;hydrochloride |
| SMILES | Cl.O=C(OCCCC[C@H](NC(=O)[C@@H]1CCCCN1)C(=O)OCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H32N2O5.ClH/c29-24(22-15-7-9-17-27-22)28-23(26(31)33-19-20-11-3-1-4-12-20)16-8-10-18-32-25(30)21-13-5-2-6-14-21;/h1-6,11-14,22-23,27H,7-10,15-19H2,(H,28,29);1H/t22-,23-;/m0./s1 |
| InChIKey | ZNAGRBPSGDTDTI-SJEIDVEUSA-N |
| XLogP | 3.81 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.01 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|