C27H28N2O3 — CID 154612158
benzyl (2S)-3,3-diphenyl-2-[[(2S)-pyrrolidine-2-carbonyl]amino]propanoate (PubChem CID 154612158) has the molecular formula C27H28N2O3 and a molecular weight of 428.53 g/mol. Its IUPAC name is benzyl (2S)-3,3-diphenyl-2-[[(2S)-pyrrolidine-2-carbonyl]amino]propanoate.
| Compound Name | benzyl (2S)-3,3-diphenyl-2-[[(2S)-pyrrolidine-2-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 154612158 |
| Molecular Formula | C27H28N2O3 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | benzyl (2S)-3,3-diphenyl-2-[[(2S)-pyrrolidine-2-carbonyl]amino]propanoate |
| SMILES | O=C(N[C@H](C(=O)OCc1ccccc1)C(c1ccccc1)c1ccccc1)[C@@H]1CCCN1 |
| InChI | InChI=1S/C27H28N2O3/c30-26(23-17-10-18-28-23)29-25(27(31)32-19-20-11-4-1-5-12-20)24(21-13-6-2-7-14-21)22-15-8-3-9-16-22/h1-9,11-16,23-25,28H,10,17-19H2,(H,29,30)/t23-,25-/m0/s1 |
| InChIKey | ZJOFWQCLYPIWOM-ZCYQVOJMSA-N |
| XLogP | 3.80 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |