C18H25N3O4 — CID 129137633
benzyl 3-[3-(pyrrolidine-2-carbonylamino)propanoylamino]propanoate (PubChem CID 129137633) has the molecular formula C18H25N3O4 and a molecular weight of 347.42 g/mol. Its IUPAC name is benzyl 3-[3-(pyrrolidine-2-carbonylamino)propanoylamino]propanoate.
| Compound Name | benzyl 3-[3-(pyrrolidine-2-carbonylamino)propanoylamino]propanoate |
|---|---|
| PubChem CID | 129137633 |
| Molecular Formula | C18H25N3O4 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | benzyl 3-[3-(pyrrolidine-2-carbonylamino)propanoylamino]propanoate |
| SMILES | O=C(CCNC(=O)C1CCCN1)NCCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H25N3O4/c22-16(8-11-21-18(24)15-7-4-10-19-15)20-12-9-17(23)25-13-14-5-2-1-3-6-14/h1-3,5-6,15,19H,4,7-13H2,(H,20,22)(H,21,24) |
| InChIKey | GQUVVCYDYZWKLR-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |