C15H20N2O3 — CID 54157501
benzyl 3-[[(3R)-pyrrolidine-3-carbonyl]amino]propanoate (PubChem CID 54157501) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is benzyl 3-[[(3R)-pyrrolidine-3-carbonyl]amino]propanoate.
| Compound Name | benzyl 3-[[(3R)-pyrrolidine-3-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 54157501 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | benzyl 3-[[(3R)-pyrrolidine-3-carbonyl]amino]propanoate |
| SMILES | O=C(CCNC(=O)[C@@H]1CCNC1)OCc1ccccc1 |
| InChI | InChI=1S/C15H20N2O3/c18-14(20-11-12-4-2-1-3-5-12)7-9-17-15(19)13-6-8-16-10-13/h1-5,13,16H,6-11H2,(H,17,19)/t13-/m1/s1 |
| InChIKey | OMCRFSBPZNTITO-CYBMUJFWSA-N |
| XLogP | 0.85 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |