C14H23Cl2N3O — CID 119867816
N-(3-anilinopropyl)pyrrolidine-3-carboxamide;dihydrochloride (PubChem CID 119867816) has the molecular formula C14H23Cl2N3O and a molecular weight of 320.26 g/mol. Its IUPAC name is N-(3-anilinopropyl)pyrrolidine-3-carboxamide;dihydrochloride.
| Compound Name | N-(3-anilinopropyl)pyrrolidine-3-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119867816 |
| Molecular Formula | C14H23Cl2N3O |
| Molecular Weight | 320.26 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | N-(3-anilinopropyl)pyrrolidine-3-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(NCCCNc1ccccc1)C1CCNC1 |
| InChI | InChI=1S/C14H21N3O.2ClH/c18-14(12-7-10-15-11-12)17-9-4-8-16-13-5-2-1-3-6-13;;/h1-3,5-6,12,15-16H,4,7-11H2,(H,17,18);2*1H |
| InChIKey | IOTHGVSCWYQTIV-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.26 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|