C14H24Cl2N4O — CID 119888081
N-[3-[(5-methyl-2-pyridinyl)amino]propyl]pyrrolidine-3-carboxamide;dihydrochloride (PubChem CID 119888081) has the molecular formula C14H24Cl2N4O and a molecular weight of 335.28 g/mol. Its IUPAC name is N-[3-[(5-methyl-2-pyridinyl)amino]propyl]pyrrolidine-3-carboxamide;dihydrochloride.
| Compound Name | N-[3-[(5-methyl-2-pyridinyl)amino]propyl]pyrrolidine-3-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119888081 |
| Molecular Formula | C14H24Cl2N4O |
| Molecular Weight | 335.28 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | N-[3-[(5-methyl-2-pyridinyl)amino]propyl]pyrrolidine-3-carboxamide;dihydrochloride |
| SMILES | Cc1ccc(NCCCNC(=O)C2CCNC2)nc1.Cl.Cl |
| InChI | InChI=1S/C14H22N4O.2ClH/c1-11-3-4-13(18-9-11)16-6-2-7-17-14(19)12-5-8-15-10-12;;/h3-4,9,12,15H,2,5-8,10H2,1H3,(H,16,18)(H,17,19);2*1H |
| InChIKey | PMWODTAWSHWVEP-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.28 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|