C18H30Cl2N4O — CID 119888049
2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[3-[(5-methyl-2-pyridinyl)amino]propyl]acetamide;dihydrochloride (PubChem CID 119888049) has the molecular formula C18H30Cl2N4O and a molecular weight of 389.37 g/mol. Its IUPAC name is 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[3-[(5-methyl-2-pyridinyl)amino]propyl]acetamide;dihydrochloride.
| Compound Name | 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[3-[(5-methyl-2-pyridinyl)amino]propyl]acetamide;dihydrochloride |
|---|---|
| PubChem CID | 119888049 |
| Molecular Formula | C18H30Cl2N4O |
| Molecular Weight | 389.37 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[3-[(5-methyl-2-pyridinyl)amino]propyl]acetamide;dihydrochloride |
| SMILES | Cc1ccc(NCCCNC(=O)CC2CC3CCC(C2)N3)nc1.Cl.Cl |
| InChI | InChI=1S/C18H28N4O.2ClH/c1-13-3-6-17(21-12-13)19-7-2-8-20-18(23)11-14-9-15-4-5-16(10-14)22-15;;/h3,6,12,14-16,22H,2,4-5,7-11H2,1H3,(H,19,21)(H,20,23);2*1H |
| InChIKey | WCVOYSULLUYCRA-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.37 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|