C19H28N2O2 — CID 124693226
2-[(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl]-N-[3-(2-methylphenoxy)propyl]acetamide (PubChem CID 124693226) has the molecular formula C19H28N2O2 and a molecular weight of 316.44 g/mol. Its IUPAC name is 2-[(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl]-N-[3-(2-methylphenoxy)propyl]acetamide.
| Compound Name | 2-[(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl]-N-[3-(2-methylphenoxy)propyl]acetamide |
|---|---|
| PubChem CID | 124693226 |
| Molecular Formula | C19H28N2O2 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | 2-[(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl]-N-[3-(2-methylphenoxy)propyl]acetamide |
| SMILES | Cc1ccccc1OCCCNC(=O)CC1C[C@H]2CC[C@@H](C1)N2 |
| InChI | InChI=1S/C19H28N2O2/c1-14-5-2-3-6-18(14)23-10-4-9-20-19(22)13-15-11-16-7-8-17(12-15)21-16/h2-3,5-6,15-17,21H,4,7-13H2,1H3,(H,20,22)/t15?,16-,17+ |
| InChIKey | SHDAABPNBVGHQM-ALOPSCKCSA-N |
| XLogP | 2.80 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|