C16H24N2O2S — CID 119938657
N-[3-(2-methylphenoxy)propyl]-2-thiomorpholin-3-ylacetamide (PubChem CID 119938657) has the molecular formula C16H24N2O2S and a molecular weight of 308.45 g/mol. Its IUPAC name is N-[3-(2-methylphenoxy)propyl]-2-thiomorpholin-3-ylacetamide.
| Compound Name | N-[3-(2-methylphenoxy)propyl]-2-thiomorpholin-3-ylacetamide |
|---|---|
| PubChem CID | 119938657 |
| Molecular Formula | C16H24N2O2S |
| Molecular Weight | 308.45 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | N-[3-(2-methylphenoxy)propyl]-2-thiomorpholin-3-ylacetamide |
| SMILES | Cc1ccccc1OCCCNC(=O)CC1CSCCN1 |
| InChI | InChI=1S/C16H24N2O2S/c1-13-5-2-3-6-15(13)20-9-4-7-18-16(19)11-14-12-21-10-8-17-14/h2-3,5-6,14,17H,4,7-12H2,1H3,(H,18,19) |
| InChIKey | YNDDQGKOZGQZDZ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.45 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|