C16H24N2O3S2 — CID 119936943
N-(3-benzylsulfonylpropyl)-2-thiomorpholin-3-ylacetamide (PubChem CID 119936943) has the molecular formula C16H24N2O3S2 and a molecular weight of 356.51 g/mol. Its IUPAC name is N-(3-benzylsulfonylpropyl)-2-thiomorpholin-3-ylacetamide.
| Compound Name | N-(3-benzylsulfonylpropyl)-2-thiomorpholin-3-ylacetamide |
|---|---|
| PubChem CID | 119936943 |
| Molecular Formula | C16H24N2O3S2 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | N-(3-benzylsulfonylpropyl)-2-thiomorpholin-3-ylacetamide |
| SMILES | O=C(CC1CSCCN1)NCCCS(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C16H24N2O3S2/c19-16(11-15-12-22-9-8-17-15)18-7-4-10-23(20,21)13-14-5-2-1-3-6-14/h1-3,5-6,15,17H,4,7-13H2,(H,18,19) |
| InChIKey | ISFQKRJQVFWNER-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|