C17H23N3OS — CID 119940745
N-(3-indol-1-ylpropyl)-2-thiomorpholin-3-ylacetamide (PubChem CID 119940745) has the molecular formula C17H23N3OS and a molecular weight of 317.46 g/mol. Its IUPAC name is N-(3-indol-1-ylpropyl)-2-thiomorpholin-3-ylacetamide.
| Compound Name | N-(3-indol-1-ylpropyl)-2-thiomorpholin-3-ylacetamide |
|---|---|
| PubChem CID | 119940745 |
| Molecular Formula | C17H23N3OS |
| Molecular Weight | 317.46 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | N-(3-indol-1-ylpropyl)-2-thiomorpholin-3-ylacetamide |
| SMILES | O=C(CC1CSCCN1)NCCCn1ccc2ccccc21 |
| InChI | InChI=1S/C17H23N3OS/c21-17(12-15-13-22-11-8-18-15)19-7-3-9-20-10-6-14-4-1-2-5-16(14)20/h1-2,4-6,10,15,18H,3,7-9,11-13H2,(H,19,21) |
| InChIKey | CJZPJTSGFQVXET-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 46.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.46 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|