C14H22Cl2N4O — CID 154911752
N-[3-[(5-methyl-2-pyridinyl)amino]propyl]-2,5-dihydro-1H-pyrrole-2-carboxamide;dihydrochloride (PubChem CID 154911752) has the molecular formula C14H22Cl2N4O and a molecular weight of 333.26 g/mol. Its IUPAC name is N-[3-[(5-methyl-2-pyridinyl)amino]propyl]-2,5-dihydro-1H-pyrrole-2-carboxamide;dihydrochloride.
| Compound Name | N-[3-[(5-methyl-2-pyridinyl)amino]propyl]-2,5-dihydro-1H-pyrrole-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 154911752 |
| Molecular Formula | C14H22Cl2N4O |
| Molecular Weight | 333.26 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | N-[3-[(5-methyl-2-pyridinyl)amino]propyl]-2,5-dihydro-1H-pyrrole-2-carboxamide;dihydrochloride |
| SMILES | Cc1ccc(NCCCNC(=O)C2C=CCN2)nc1.Cl.Cl |
| InChI | InChI=1S/C14H20N4O.2ClH/c1-11-5-6-13(18-10-11)16-8-3-9-17-14(19)12-4-2-7-15-12;;/h2,4-6,10,12,15H,3,7-9H2,1H3,(H,16,18)(H,17,19);2*1H |
| InChIKey | XKZNZEFOGYLBLU-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.26 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|