C19H24N4O2 — CID 51092809
1-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-3-[3-[(5-methyl-2-pyridinyl)amino]propyl]urea (PubChem CID 51092809) has the molecular formula C19H24N4O2 and a molecular weight of 340.43 g/mol. Its IUPAC name is 1-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-3-[3-[(5-methyl-2-pyridinyl)amino]propyl]urea.
| Compound Name | 1-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-3-[3-[(5-methyl-2-pyridinyl)amino]propyl]urea |
|---|---|
| PubChem CID | 51092809 |
| Molecular Formula | C19H24N4O2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | 1-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-3-[3-[(5-methyl-2-pyridinyl)amino]propyl]urea |
| SMILES | Cc1ccc(NCCCNC(=O)N[C@@H]2c3ccccc3C[C@@H]2O)nc1 |
| InChI | InChI=1S/C19H24N4O2/c1-13-7-8-17(22-12-13)20-9-4-10-21-19(25)23-18-15-6-3-2-5-14(15)11-16(18)24/h2-3,5-8,12,16,18,24H,4,9-11H2,1H3,(H,20,22)(H2,21,23,25)/t16-,18+/m0/s1 |
| InChIKey | JWJMJUWPKBPMFB-FUHWJXTLSA-N |
| XLogP | 2.15 |
| TPSA | 86.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|