C20H23N3O3 — CID 136525095
N-[2-[(2-hydroxy-2,3-dihydro-1H-inden-1-yl)carbamoylamino]ethyl]-4-methylbenzamide (PubChem CID 136525095) has the molecular formula C20H23N3O3 and a molecular weight of 353.42 g/mol. Its IUPAC name is N-[2-[(2-hydroxy-2,3-dihydro-1H-inden-1-yl)carbamoylamino]ethyl]-4-methylbenzamide.
| Compound Name | N-[2-[(2-hydroxy-2,3-dihydro-1H-inden-1-yl)carbamoylamino]ethyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 136525095 |
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | N-[2-[(2-hydroxy-2,3-dihydro-1H-inden-1-yl)carbamoylamino]ethyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NCCNC(=O)NC2c3ccccc3CC2O)cc1 |
| InChI | InChI=1S/C20H23N3O3/c1-13-6-8-14(9-7-13)19(25)21-10-11-22-20(26)23-18-16-5-3-2-4-15(16)12-17(18)24/h2-9,17-18,24H,10-12H2,1H3,(H,21,25)(H2,22,23,26) |
| InChIKey | BUIYBJKFLHFGPP-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|