C17H26N2O3 — CID 110908580
1-(2-hydroxy-2,3-dihydro-1H-inden-1-yl)-3-[2-(3-methylbutoxy)ethyl]urea (PubChem CID 110908580) has the molecular formula C17H26N2O3 and a molecular weight of 306.41 g/mol. Its IUPAC name is 1-(2-hydroxy-2,3-dihydro-1H-inden-1-yl)-3-[2-(3-methylbutoxy)ethyl]urea.
| Compound Name | 1-(2-hydroxy-2,3-dihydro-1H-inden-1-yl)-3-[2-(3-methylbutoxy)ethyl]urea |
|---|---|
| PubChem CID | 110908580 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | 1-(2-hydroxy-2,3-dihydro-1H-inden-1-yl)-3-[2-(3-methylbutoxy)ethyl]urea |
| SMILES | CC(C)CCOCCNC(=O)NC1c2ccccc2CC1O |
| InChI | InChI=1S/C17H26N2O3/c1-12(2)7-9-22-10-8-18-17(21)19-16-14-6-4-3-5-13(14)11-15(16)20/h3-6,12,15-16,20H,7-11H2,1-2H3,(H2,18,19,21) |
| InChIKey | MMMZEKNIRWDEIF-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|