C16H24N2O3 — CID 110923399
1-(2-butoxyethyl)-3-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]urea (PubChem CID 110923399) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is 1-(2-butoxyethyl)-3-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]urea.
| Compound Name | 1-(2-butoxyethyl)-3-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]urea |
|---|---|
| PubChem CID | 110923399 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | 1-(2-butoxyethyl)-3-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]urea |
| SMILES | CCCCOCCNC(=O)N[C@H]1c2ccccc2C[C@H]1O |
| InChI | InChI=1S/C16H24N2O3/c1-2-3-9-21-10-8-17-16(20)18-15-13-7-5-4-6-12(13)11-14(15)19/h4-7,14-15,19H,2-3,8-11H2,1H3,(H2,17,18,20)/t14-,15+/m1/s1 |
| InChIKey | MEKDNUYGJLQZFB-CABCVRRESA-N |
| XLogP | 1.76 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|