C19H29N3O2 — CID 110904213
1-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-3-[3-(4-methylpiperidin-1-yl)propyl]urea (PubChem CID 110904213) has the molecular formula C19H29N3O2 and a molecular weight of 331.46 g/mol. Its IUPAC name is 1-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-3-[3-(4-methylpiperidin-1-yl)propyl]urea.
| Compound Name | 1-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-3-[3-(4-methylpiperidin-1-yl)propyl]urea |
|---|---|
| PubChem CID | 110904213 |
| Molecular Formula | C19H29N3O2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | 1-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-3-[3-(4-methylpiperidin-1-yl)propyl]urea |
| SMILES | CC1CCN(CCCNC(=O)N[C@@H]2c3ccccc3C[C@@H]2O)CC1 |
| InChI | InChI=1S/C19H29N3O2/c1-14-7-11-22(12-8-14)10-4-9-20-19(24)21-18-16-6-3-2-5-15(16)13-17(18)23/h2-3,5-6,14,17-18,23H,4,7-13H2,1H3,(H2,20,21,24)/t17-,18+/m0/s1 |
| InChIKey | LFGHWUSTORHPME-ZWKOTPCHSA-N |
| XLogP | 2.07 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|