C13H18N2O2 — CID 111116927
1-(2-hydroxyethyl)-3-(2-methyl-2,3-dihydro-1H-inden-1-yl)urea (PubChem CID 111116927) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-3-(2-methyl-2,3-dihydro-1H-inden-1-yl)urea.
| Compound Name | 1-(2-hydroxyethyl)-3-(2-methyl-2,3-dihydro-1H-inden-1-yl)urea |
|---|---|
| PubChem CID | 111116927 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 1-(2-hydroxyethyl)-3-(2-methyl-2,3-dihydro-1H-inden-1-yl)urea |
| SMILES | CC1Cc2ccccc2C1NC(=O)NCCO |
| InChI | InChI=1S/C13H18N2O2/c1-9-8-10-4-2-3-5-11(10)12(9)15-13(17)14-6-7-16/h2-5,9,12,16H,6-8H2,1H3,(H2,14,15,17) |
| InChIKey | AASLLNYHFMUDGQ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |