C18H28N2O2 — CID 111506246
1-(5-hydroxy-4,4-dimethylpentyl)-3-(2-methyl-2,3-dihydro-1H-inden-1-yl)urea (PubChem CID 111506246) has the molecular formula C18H28N2O2 and a molecular weight of 304.43 g/mol. Its IUPAC name is 1-(5-hydroxy-4,4-dimethylpentyl)-3-(2-methyl-2,3-dihydro-1H-inden-1-yl)urea.
| Compound Name | 1-(5-hydroxy-4,4-dimethylpentyl)-3-(2-methyl-2,3-dihydro-1H-inden-1-yl)urea |
|---|---|
| PubChem CID | 111506246 |
| Molecular Formula | C18H28N2O2 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | 1-(5-hydroxy-4,4-dimethylpentyl)-3-(2-methyl-2,3-dihydro-1H-inden-1-yl)urea |
| SMILES | CC1Cc2ccccc2C1NC(=O)NCCCC(C)(C)CO |
| InChI | InChI=1S/C18H28N2O2/c1-13-11-14-7-4-5-8-15(14)16(13)20-17(22)19-10-6-9-18(2,3)12-21/h4-5,7-8,13,16,21H,6,9-12H2,1-3H3,(H2,19,20,22) |
| InChIKey | OIWZAMMPWKYAJD-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|