C15H30N2O2 — CID 111503873
1-(5-hydroxy-4,4-dimethylpentyl)-3-(2-methylcyclohexyl)urea (PubChem CID 111503873) has the molecular formula C15H30N2O2 and a molecular weight of 270.42 g/mol. Its IUPAC name is 1-(5-hydroxy-4,4-dimethylpentyl)-3-(2-methylcyclohexyl)urea.
| Compound Name | 1-(5-hydroxy-4,4-dimethylpentyl)-3-(2-methylcyclohexyl)urea |
|---|---|
| PubChem CID | 111503873 |
| Molecular Formula | C15H30N2O2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.23 |
| IUPAC Name | 1-(5-hydroxy-4,4-dimethylpentyl)-3-(2-methylcyclohexyl)urea |
| SMILES | CC1CCCCC1NC(=O)NCCCC(C)(C)CO |
| InChI | InChI=1S/C15H30N2O2/c1-12-7-4-5-8-13(12)17-14(19)16-10-6-9-15(2,3)11-18/h12-13,18H,4-11H2,1-3H3,(H2,16,17,19) |
| InChIKey | RTPKSHZWHXTCRW-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|