C16H32N2O2 — CID 111505061
1-(4-ethylcyclohexyl)-3-(5-hydroxy-4,4-dimethylpentyl)urea (PubChem CID 111505061) has the molecular formula C16H32N2O2 and a molecular weight of 284.44 g/mol. Its IUPAC name is 1-(4-ethylcyclohexyl)-3-(5-hydroxy-4,4-dimethylpentyl)urea.
| Compound Name | 1-(4-ethylcyclohexyl)-3-(5-hydroxy-4,4-dimethylpentyl)urea |
|---|---|
| PubChem CID | 111505061 |
| Molecular Formula | C16H32N2O2 |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.25 |
| IUPAC Name | 1-(4-ethylcyclohexyl)-3-(5-hydroxy-4,4-dimethylpentyl)urea |
| SMILES | CCC1CCC(NC(=O)NCCCC(C)(C)CO)CC1 |
| InChI | InChI=1S/C16H32N2O2/c1-4-13-6-8-14(9-7-13)18-15(20)17-11-5-10-16(2,3)12-19/h13-14,19H,4-12H2,1-3H3,(H2,17,18,20) |
| InChIKey | MONQSLKYRLWAFC-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|