C15H23N3O4S — CID 51092812
1-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-3-[3-[methyl(methylsulfonyl)amino]propyl]urea (PubChem CID 51092812) has the molecular formula C15H23N3O4S and a molecular weight of 341.43 g/mol. Its IUPAC name is 1-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-3-[3-[methyl(methylsulfonyl)amino]propyl]urea.
| Compound Name | 1-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-3-[3-[methyl(methylsulfonyl)amino]propyl]urea |
|---|---|
| PubChem CID | 51092812 |
| Molecular Formula | C15H23N3O4S |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 1-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-3-[3-[methyl(methylsulfonyl)amino]propyl]urea |
| SMILES | CN(CCCNC(=O)N[C@@H]1c2ccccc2C[C@@H]1O)S(C)(=O)=O |
| InChI | InChI=1S/C15H23N3O4S/c1-18(23(2,21)22)9-5-8-16-15(20)17-14-12-7-4-3-6-11(12)10-13(14)19/h3-4,6-7,13-14,19H,5,8-10H2,1-2H3,(H2,16,17,20)/t13-,14+/m0/s1 |
| InChIKey | GZWGNVFIFNSDPI-UONOGXRCSA-N |
| XLogP | 0.23 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|