C19H24N4O2 — CID 51957688
1-[(4R)-3,4-dihydro-2H-chromen-4-yl]-3-[3-[(5-methyl-2-pyridinyl)amino]propyl]urea (PubChem CID 51957688) has the molecular formula C19H24N4O2 and a molecular weight of 340.43 g/mol. Its IUPAC name is 1-[(4R)-3,4-dihydro-2H-chromen-4-yl]-3-[3-[(5-methyl-2-pyridinyl)amino]propyl]urea.
| Compound Name | 1-[(4R)-3,4-dihydro-2H-chromen-4-yl]-3-[3-[(5-methyl-2-pyridinyl)amino]propyl]urea |
|---|---|
| PubChem CID | 51957688 |
| Molecular Formula | C19H24N4O2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | 1-[(4R)-3,4-dihydro-2H-chromen-4-yl]-3-[3-[(5-methyl-2-pyridinyl)amino]propyl]urea |
| SMILES | Cc1ccc(NCCCNC(=O)N[C@@H]2CCOc3ccccc32)nc1 |
| InChI | InChI=1S/C19H24N4O2/c1-14-7-8-18(22-13-14)20-10-4-11-21-19(24)23-16-9-12-25-17-6-3-2-5-15(16)17/h2-3,5-8,13,16H,4,9-12H2,1H3,(H,20,22)(H2,21,23,24)/t16-/m1/s1 |
| InChIKey | YOAHXEWBPUYEKC-MRXNPFEDSA-N |
| XLogP | 3.02 |
| TPSA | 75.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|