C18H20N2O2 — CID 110866349
1-(3,4-dihydro-2H-chromen-4-yl)-3-(2,6-dimethylphenyl)urea (PubChem CID 110866349) has the molecular formula C18H20N2O2 and a molecular weight of 296.37 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-chromen-4-yl)-3-(2,6-dimethylphenyl)urea.
| Compound Name | 1-(3,4-dihydro-2H-chromen-4-yl)-3-(2,6-dimethylphenyl)urea |
|---|---|
| PubChem CID | 110866349 |
| Molecular Formula | C18H20N2O2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | 1-(3,4-dihydro-2H-chromen-4-yl)-3-(2,6-dimethylphenyl)urea |
| SMILES | Cc1cccc(C)c1NC(=O)NC1CCOc2ccccc21 |
| InChI | InChI=1S/C18H20N2O2/c1-12-6-5-7-13(2)17(12)20-18(21)19-15-10-11-22-16-9-4-3-8-14(15)16/h3-9,15H,10-11H2,1-2H3,(H2,19,20,21) |
| InChIKey | GDNIGGCUFWJGMU-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |