C16H17N3O2 — CID 62367144
1-(3-aminophenyl)-3-(3,4-dihydro-2H-chromen-4-yl)urea (PubChem CID 62367144) has the molecular formula C16H17N3O2 and a molecular weight of 283.33 g/mol. Its IUPAC name is 1-(3-aminophenyl)-3-(3,4-dihydro-2H-chromen-4-yl)urea.
| Compound Name | 1-(3-aminophenyl)-3-(3,4-dihydro-2H-chromen-4-yl)urea |
|---|---|
| PubChem CID | 62367144 |
| Molecular Formula | C16H17N3O2 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | 1-(3-aminophenyl)-3-(3,4-dihydro-2H-chromen-4-yl)urea |
| SMILES | Nc1cccc(NC(=O)NC2CCOc3ccccc32)c1 |
| InChI | InChI=1S/C16H17N3O2/c17-11-4-3-5-12(10-11)18-16(20)19-14-8-9-21-15-7-2-1-6-13(14)15/h1-7,10,14H,8-9,17H2,(H2,18,19,20) |
| InChIKey | ARLZCGKQQBMNOM-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|