C16H17N3O4S — CID 94177707
1-[(4S)-3,4-dihydro-2H-chromen-4-yl]-3-(6-methylsulfonyl-3-pyridinyl)urea (PubChem CID 94177707) has the molecular formula C16H17N3O4S and a molecular weight of 347.40 g/mol. Its IUPAC name is 1-[(4S)-3,4-dihydro-2H-chromen-4-yl]-3-(6-methylsulfonyl-3-pyridinyl)urea.
| Compound Name | 1-[(4S)-3,4-dihydro-2H-chromen-4-yl]-3-(6-methylsulfonyl-3-pyridinyl)urea |
|---|---|
| PubChem CID | 94177707 |
| Molecular Formula | C16H17N3O4S |
| Molecular Weight | 347.40 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 1-[(4S)-3,4-dihydro-2H-chromen-4-yl]-3-(6-methylsulfonyl-3-pyridinyl)urea |
| SMILES | CS(=O)(=O)c1ccc(NC(=O)N[C@H]2CCOc3ccccc32)cn1 |
| InChI | InChI=1S/C16H17N3O4S/c1-24(21,22)15-7-6-11(10-17-15)18-16(20)19-13-8-9-23-14-5-3-2-4-12(13)14/h2-7,10,13H,8-9H2,1H3,(H2,18,19,20)/t13-/m0/s1 |
| InChIKey | FLCVVQSHCOAIKD-ZDUSSCGKSA-N |
| XLogP | 2.13 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.40 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |