C10H13NO3S — CID 94197081
N-[(4R)-3,4-dihydro-2H-chromen-4-yl]methanesulfonamide (PubChem CID 94197081) has the molecular formula C10H13NO3S and a molecular weight of 227.28 g/mol. Its IUPAC name is N-[(4R)-3,4-dihydro-2H-chromen-4-yl]methanesulfonamide.
| Compound Name | N-[(4R)-3,4-dihydro-2H-chromen-4-yl]methanesulfonamide |
|---|---|
| PubChem CID | 94197081 |
| Molecular Formula | C10H13NO3S |
| Molecular Weight | 227.28 g/mol |
| Exact Mass | 227.06 |
| IUPAC Name | N-[(4R)-3,4-dihydro-2H-chromen-4-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)N[C@@H]1CCOc2ccccc21 |
| InChI | InChI=1S/C10H13NO3S/c1-15(12,13)11-9-6-7-14-10-5-3-2-4-8(9)10/h2-5,9,11H,6-7H2,1H3/t9-/m1/s1 |
| InChIKey | GLQMCOZZWSNYPN-SECBINFHSA-N |
| XLogP | 1.06 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.28 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |