C12H19NO — CID 143399161
ethane;N-methyl-3,4-dihydro-2H-chromen-4-amine (PubChem CID 143399161) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is ethane;N-methyl-3,4-dihydro-2H-chromen-4-amine.
| Compound Name | ethane;N-methyl-3,4-dihydro-2H-chromen-4-amine |
|---|---|
| PubChem CID | 143399161 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | ethane;N-methyl-3,4-dihydro-2H-chromen-4-amine |
| SMILES | CC.CNC1CCOc2ccccc21 |
| InChI | InChI=1S/C10H13NO.C2H6/c1-11-9-6-7-12-10-5-3-2-4-8(9)10;1-2/h2-5,9,11H,6-7H2,1H3;1-2H3 |
| InChIKey | FUPKXLSXINEMSJ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |