C9H10INO — CID 163411426
(4R)-N-iodo-3,4-dihydro-2H-chromen-4-amine (PubChem CID 163411426) has the molecular formula C9H10INO and a molecular weight of 275.09 g/mol. Its IUPAC name is (4R)-N-iodo-3,4-dihydro-2H-chromen-4-amine.
| Compound Name | (4R)-N-iodo-3,4-dihydro-2H-chromen-4-amine |
|---|---|
| PubChem CID | 163411426 |
| Molecular Formula | C9H10INO |
| Molecular Weight | 275.09 g/mol |
| Exact Mass | 274.98 |
| IUPAC Name | (4R)-N-iodo-3,4-dihydro-2H-chromen-4-amine |
| SMILES | IN[C@@H]1CCOc2ccccc21 |
| InChI | InChI=1S/C9H10INO/c10-11-8-5-6-12-9-4-2-1-3-7(8)9/h1-4,8,11H,5-6H2/t8-/m1/s1 |
| InChIKey | AAVBWKNFELKHCN-MRVPVSSYSA-N |
| XLogP | 2.45 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.09 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|