C11H13NO — CID 156742889
(4S)-N-ethenyl-3,4-dihydro-2H-chromen-4-amine (PubChem CID 156742889) has the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. Its IUPAC name is (4S)-N-ethenyl-3,4-dihydro-2H-chromen-4-amine.
| Compound Name | (4S)-N-ethenyl-3,4-dihydro-2H-chromen-4-amine |
|---|---|
| PubChem CID | 156742889 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | (4S)-N-ethenyl-3,4-dihydro-2H-chromen-4-amine |
| SMILES | C=CN[C@H]1CCOc2ccccc21 |
| InChI | InChI=1S/C11H13NO/c1-2-12-10-7-8-13-11-6-4-3-5-9(10)11/h2-6,10,12H,1,7-8H2/t10-/m0/s1 |
| InChIKey | RVPJQOVWAKTSDM-JTQLQIEISA-N |
| XLogP | 2.24 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |