C13H17NO — CID 43190759
N-(cyclopropylmethyl)-3,4-dihydro-2H-chromen-4-amine (PubChem CID 43190759) has the molecular formula C13H17NO and a molecular weight of 203.28 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-3,4-dihydro-2H-chromen-4-amine.
| Compound Name | N-(cyclopropylmethyl)-3,4-dihydro-2H-chromen-4-amine |
|---|---|
| PubChem CID | 43190759 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | N-(cyclopropylmethyl)-3,4-dihydro-2H-chromen-4-amine |
| SMILES | c1ccc2c(c1)OCCC2NCC1CC1 |
| InChI | InChI=1S/C13H17NO/c1-2-4-13-11(3-1)12(7-8-15-13)14-9-10-5-6-10/h1-4,10,12,14H,5-9H2 |
| InChIKey | IFKVYIJOSBRPBC-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |