C15H23NO — CID 94276035
(4S)-N-(3,3-dimethylbutyl)-3,4-dihydro-2H-chromen-4-amine (PubChem CID 94276035) has the molecular formula C15H23NO and a molecular weight of 233.35 g/mol. Its IUPAC name is (4S)-N-(3,3-dimethylbutyl)-3,4-dihydro-2H-chromen-4-amine.
| Compound Name | (4S)-N-(3,3-dimethylbutyl)-3,4-dihydro-2H-chromen-4-amine |
|---|---|
| PubChem CID | 94276035 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | (4S)-N-(3,3-dimethylbutyl)-3,4-dihydro-2H-chromen-4-amine |
| SMILES | CC(C)(C)CCN[C@H]1CCOc2ccccc21 |
| InChI | InChI=1S/C15H23NO/c1-15(2,3)9-10-16-13-8-11-17-14-7-5-4-6-12(13)14/h4-7,13,16H,8-11H2,1-3H3/t13-/m0/s1 |
| InChIKey | FCPVGEUXXFFMEI-ZDUSSCGKSA-N |
| XLogP | 3.54 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |